C16H18N6O — CID 72851598
(3R,4S)-4-(3-methoxyphenyl)-1-(7H-purin-6-yl)pyrrolidin-3-amine (PubChem CID 72851598) has the molecular formula C16H18N6O and a molecular weight of 310.36 g/mol. Its IUPAC name is (3R,4S)-4-(3-methoxyphenyl)-1-(7H-purin-6-yl)pyrrolidin-3-amine.
| Compound Name | (3R,4S)-4-(3-methoxyphenyl)-1-(7H-purin-6-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 72851598 |
| Molecular Formula | C16H18N6O |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | (3R,4S)-4-(3-methoxyphenyl)-1-(7H-purin-6-yl)pyrrolidin-3-amine |
| SMILES | COc1cccc([C@H]2CN(c3ncnc4nc[nH]c34)C[C@@H]2N)c1 |
| InChI | InChI=1S/C16H18N6O/c1-23-11-4-2-3-10(5-11)12-6-22(7-13(12)17)16-14-15(19-8-18-14)20-9-21-16/h2-5,8-9,12-13H,6-7,17H2,1H3,(H,18,19,20,21)/t12-,13+/m1/s1 |
| InChIKey | AYKARLAIKYRSKC-OLZOCXBDSA-N |
| XLogP | 1.29 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |