C16H17FN6O — CID 133348137
6-[4-(3-fluoro-4-methoxyphenyl)piperazin-1-yl]-7H-purine (PubChem CID 133348137) has the molecular formula C16H17FN6O and a molecular weight of 328.35 g/mol. Its IUPAC name is 6-[4-(3-fluoro-4-methoxyphenyl)piperazin-1-yl]-7H-purine.
| Compound Name | 6-[4-(3-fluoro-4-methoxyphenyl)piperazin-1-yl]-7H-purine |
|---|---|
| PubChem CID | 133348137 |
| Molecular Formula | C16H17FN6O |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 6-[4-(3-fluoro-4-methoxyphenyl)piperazin-1-yl]-7H-purine |
| SMILES | COc1ccc(N2CCN(c3ncnc4nc[nH]c34)CC2)cc1F |
| InChI | InChI=1S/C16H17FN6O/c1-24-13-3-2-11(8-12(13)17)22-4-6-23(7-5-22)16-14-15(19-9-18-14)20-10-21-16/h2-3,8-10H,4-7H2,1H3,(H,18,19,20,21) |
| InChIKey | VBHPTAPCXZZCJB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|