C17H16N8 — CID 126894249
6-[4-(7H-purin-6-yl)piperazin-1-yl]quinazoline (PubChem CID 126894249) has the molecular formula C17H16N8 and a molecular weight of 332.37 g/mol. Its IUPAC name is 6-[4-(7H-purin-6-yl)piperazin-1-yl]quinazoline.
| Compound Name | 6-[4-(7H-purin-6-yl)piperazin-1-yl]quinazoline |
|---|---|
| PubChem CID | 126894249 |
| Molecular Formula | C17H16N8 |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 6-[4-(7H-purin-6-yl)piperazin-1-yl]quinazoline |
| SMILES | c1ncc2cc(N3CCN(c4ncnc5nc[nH]c45)CC3)ccc2n1 |
| InChI | InChI=1S/C17H16N8/c1-2-14-12(8-18-9-19-14)7-13(1)24-3-5-25(6-4-24)17-15-16(21-10-20-15)22-11-23-17/h1-2,7-11H,3-6H2,(H,20,21,22,23) |
| InChIKey | INMZSECUGOLHCH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |