About (4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone
(4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone (PubChem CID 126894181) has the molecular formula C15H15N7O
and a molecular weight of 309.33 g/mol. Its IUPAC name is (4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone.
Molecular Properties
| Compound Name | (4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone |
| PubChem CID | 126894181 |
| Molecular Formula | C15H15N7O |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone |
| SMILES | O=C(c1ncn[nH]1)N1CCN(c2ccc3ncncc3c2)CC1 |
| InChI | InChI=1S/C15H15N7O/c23-15(14-18-10-19-20-14)22-5-3-21(4-6-22)12-1-2-13-11(7-12)8-16-9-17-13/h1-2,7-10H,3-6H2,(H,18,19,20) |
| InChIKey | NAADHTPFOHQBJW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone?
The IUPAC name of (4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone (CID 126894181) is (4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone.
What is the SMILES notation for (4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone?
The canonical SMILES for (4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone is O=C(c1ncn[nH]1)N1CCN(c2ccc3ncncc3c2)CC1.
What is the InChIKey of (4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone?
The InChIKey is NAADHTPFOHQBJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N7O/c23-15(14-18-10-19-20-14)22-5-3-21(4-6-22)12-1-2-13-11(7-12)8-16-9-17-13/h1-2,7-10H,3-6H2,(H,18,19,20).
What are the key properties of (4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone?
(4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone has a molecular weight of 309.33 g/mol, XLogP of 0.71, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone is sourced from PubChem (CID 126894181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).