C15H15N7O — CID 126894181
(4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone (PubChem CID 126894181) has the molecular formula C15H15N7O and a molecular weight of 309.33 g/mol. Its IUPAC name is (4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone.
| Compound Name | (4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone |
|---|---|
| PubChem CID | 126894181 |
| Molecular Formula | C15H15N7O |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | (4-quinazolin-6-ylpiperazin-1-yl)-(1H-1,2,4-triazol-5-yl)methanone |
| SMILES | O=C(c1ncn[nH]1)N1CCN(c2ccc3ncncc3c2)CC1 |
| InChI | InChI=1S/C15H15N7O/c23-15(14-18-10-19-20-14)22-5-3-21(4-6-22)12-1-2-13-11(7-12)8-16-9-17-13/h1-2,7-10H,3-6H2,(H,18,19,20) |
| InChIKey | NAADHTPFOHQBJW-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |