C16H16N6OS — CID 126894138
(4-methylthiadiazol-5-yl)-(4-quinazolin-6-ylpiperazin-1-yl)methanone (PubChem CID 126894138) has the molecular formula C16H16N6OS and a molecular weight of 340.41 g/mol. Its IUPAC name is (4-methylthiadiazol-5-yl)-(4-quinazolin-6-ylpiperazin-1-yl)methanone.
| Compound Name | (4-methylthiadiazol-5-yl)-(4-quinazolin-6-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 126894138 |
| Molecular Formula | C16H16N6OS |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | (4-methylthiadiazol-5-yl)-(4-quinazolin-6-ylpiperazin-1-yl)methanone |
| SMILES | Cc1nnsc1C(=O)N1CCN(c2ccc3ncncc3c2)CC1 |
| InChI | InChI=1S/C16H16N6OS/c1-11-15(24-20-19-11)16(23)22-6-4-21(5-7-22)13-2-3-14-12(8-13)9-17-10-18-14/h2-3,8-10H,4-7H2,1H3 |
| InChIKey | SMDYVBXYDXTCDL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |