C17H20N8 — CID 154580454
6-[4-(2-cyclopropyl-6-methylpyrimidin-4-yl)piperazin-1-yl]-7H-purine (PubChem CID 154580454) has the molecular formula C17H20N8 and a molecular weight of 336.40 g/mol. Its IUPAC name is 6-[4-(2-cyclopropyl-6-methylpyrimidin-4-yl)piperazin-1-yl]-7H-purine.
| Compound Name | 6-[4-(2-cyclopropyl-6-methylpyrimidin-4-yl)piperazin-1-yl]-7H-purine |
|---|---|
| PubChem CID | 154580454 |
| Molecular Formula | C17H20N8 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 6-[4-(2-cyclopropyl-6-methylpyrimidin-4-yl)piperazin-1-yl]-7H-purine |
| SMILES | Cc1cc(N2CCN(c3ncnc4nc[nH]c34)CC2)nc(C2CC2)n1 |
| InChI | InChI=1S/C17H20N8/c1-11-8-13(23-15(22-11)12-2-3-12)24-4-6-25(7-5-24)17-14-16(19-9-18-14)20-10-21-17/h8-10,12H,2-7H2,1H3,(H,18,19,20,21) |
| InChIKey | VQQBPEIUJNKQHD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |