C17H18BrN5 — CID 133495949
6-[4-(4-bromo-3-methylphenyl)piperidin-1-yl]-7H-purine (PubChem CID 133495949) has the molecular formula C17H18BrN5 and a molecular weight of 372.27 g/mol. Its IUPAC name is 6-[4-(4-bromo-3-methylphenyl)piperidin-1-yl]-7H-purine.
| Compound Name | 6-[4-(4-bromo-3-methylphenyl)piperidin-1-yl]-7H-purine |
|---|---|
| PubChem CID | 133495949 |
| Molecular Formula | C17H18BrN5 |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 6-[4-(4-bromo-3-methylphenyl)piperidin-1-yl]-7H-purine |
| SMILES | Cc1cc(C2CCN(c3ncnc4nc[nH]c34)CC2)ccc1Br |
| InChI | InChI=1S/C17H18BrN5/c1-11-8-13(2-3-14(11)18)12-4-6-23(7-5-12)17-15-16(20-9-19-15)21-10-22-17/h2-3,8-10,12H,4-7H2,1H3,(H,19,20,21,22) |
| InChIKey | OVRDXRWKFKLVIP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |