C12H17N5O2 — CID 138385634
1-[1-(7H-purin-6-yl)piperidin-4-yl]ethane-1,2-diol (PubChem CID 138385634) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-[1-(7H-purin-6-yl)piperidin-4-yl]ethane-1,2-diol.
| Compound Name | 1-[1-(7H-purin-6-yl)piperidin-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 138385634 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-[1-(7H-purin-6-yl)piperidin-4-yl]ethane-1,2-diol |
| SMILES | OCC(O)C1CCN(c2ncnc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C12H17N5O2/c18-5-9(19)8-1-3-17(4-2-8)12-10-11(14-6-13-10)15-7-16-12/h6-9,18-19H,1-5H2,(H,13,14,15,16) |
| InChIKey | RPARBIVBMKOOCC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 98.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |