C17H18ClN5 — CID 67232922
6-[4-[(4-chlorophenyl)methyl]piperidin-1-yl]-7H-purine (PubChem CID 67232922) has the molecular formula C17H18ClN5 and a molecular weight of 327.82 g/mol. Its IUPAC name is 6-[4-[(4-chlorophenyl)methyl]piperidin-1-yl]-7H-purine.
| Compound Name | 6-[4-[(4-chlorophenyl)methyl]piperidin-1-yl]-7H-purine |
|---|---|
| PubChem CID | 67232922 |
| Molecular Formula | C17H18ClN5 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 6-[4-[(4-chlorophenyl)methyl]piperidin-1-yl]-7H-purine |
| SMILES | Clc1ccc(CC2CCN(c3ncnc4nc[nH]c34)CC2)cc1 |
| InChI | InChI=1S/C17H18ClN5/c18-14-3-1-12(2-4-14)9-13-5-7-23(8-6-13)17-15-16(20-10-19-15)21-11-22-17/h1-4,10-11,13H,5-9H2,(H,19,20,21,22) |
| InChIKey | ZKTWYSMNYKEERP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |