C19H20N8O — CID 56709371
4-benzyl-3-[1-(7H-purin-6-yl)piperidin-4-yl]-1H-1,2,4-triazol-5-one (PubChem CID 56709371) has the molecular formula C19H20N8O and a molecular weight of 376.42 g/mol. Its IUPAC name is 4-benzyl-3-[1-(7H-purin-6-yl)piperidin-4-yl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-benzyl-3-[1-(7H-purin-6-yl)piperidin-4-yl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 56709371 |
| Molecular Formula | C19H20N8O |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 4-benzyl-3-[1-(7H-purin-6-yl)piperidin-4-yl]-1H-1,2,4-triazol-5-one |
| SMILES | O=c1[nH]nc(C2CCN(c3ncnc4nc[nH]c34)CC2)n1Cc1ccccc1 |
| InChI | InChI=1S/C19H20N8O/c28-19-25-24-17(27(19)10-13-4-2-1-3-5-13)14-6-8-26(9-7-14)18-15-16(21-11-20-15)22-12-23-18/h1-5,11-12,14H,6-10H2,(H,25,28)(H,20,21,22,23) |
| InChIKey | RTKQWBUGVIZEMM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 108.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |