C19H20N6O — CID 126425496
(3S)-3-phenyl-8-(7H-purin-6-yl)-1,8-diazaspiro[4.5]decan-2-one (PubChem CID 126425496) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is (3S)-3-phenyl-8-(7H-purin-6-yl)-1,8-diazaspiro[4.5]decan-2-one.
| Compound Name | (3S)-3-phenyl-8-(7H-purin-6-yl)-1,8-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 126425496 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (3S)-3-phenyl-8-(7H-purin-6-yl)-1,8-diazaspiro[4.5]decan-2-one |
| SMILES | O=C1NC2(CCN(c3ncnc4nc[nH]c34)CC2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H20N6O/c26-18-14(13-4-2-1-3-5-13)10-19(24-18)6-8-25(9-7-19)17-15-16(21-11-20-15)22-12-23-17/h1-5,11-12,14H,6-10H2,(H,24,26)(H,20,21,22,23)/t14-/m0/s1 |
| InChIKey | VRHUNHYYHMKUFK-AWEZNQCLSA-N |
| XLogP | 2.00 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |