C15H15N5S — CID 75431449
2-phenyl-4-(7H-purin-6-yl)thiomorpholine (PubChem CID 75431449) has the molecular formula C15H15N5S and a molecular weight of 297.39 g/mol. Its IUPAC name is 2-phenyl-4-(7H-purin-6-yl)thiomorpholine.
| Compound Name | 2-phenyl-4-(7H-purin-6-yl)thiomorpholine |
|---|---|
| PubChem CID | 75431449 |
| Molecular Formula | C15H15N5S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 2-phenyl-4-(7H-purin-6-yl)thiomorpholine |
| SMILES | c1ccc(C2CN(c3ncnc4nc[nH]c34)CCS2)cc1 |
| InChI | InChI=1S/C15H15N5S/c1-2-4-11(5-3-1)12-8-20(6-7-21-12)15-13-14(17-9-16-13)18-10-19-15/h1-5,9-10,12H,6-8H2,(H,16,17,18,19) |
| InChIKey | CBQKYLXBAHDLBB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |