C14H13N5O — CID 70753701
2-(7H-purin-6-yl)-3,4-dihydro-1H-isoquinolin-4-ol (PubChem CID 70753701) has the molecular formula C14H13N5O and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-(7H-purin-6-yl)-3,4-dihydro-1H-isoquinolin-4-ol.
| Compound Name | 2-(7H-purin-6-yl)-3,4-dihydro-1H-isoquinolin-4-ol |
|---|---|
| PubChem CID | 70753701 |
| Molecular Formula | C14H13N5O |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-(7H-purin-6-yl)-3,4-dihydro-1H-isoquinolin-4-ol |
| SMILES | OC1CN(c2ncnc3nc[nH]c23)Cc2ccccc21 |
| InChI | InChI=1S/C14H13N5O/c20-11-6-19(5-9-3-1-2-4-10(9)11)14-12-13(16-7-15-12)17-8-18-14/h1-4,7-8,11,20H,5-6H2,(H,15,16,17,18) |
| InChIKey | FMAFXOVQVRXQSN-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |