C18H18N6O — CID 172903825
2,3-dihydroindol-1-yl-[1-(7H-purin-6-yl)pyrrolidin-3-yl]methanone (PubChem CID 172903825) has the molecular formula C18H18N6O and a molecular weight of 334.38 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-[1-(7H-purin-6-yl)pyrrolidin-3-yl]methanone.
| Compound Name | 2,3-dihydroindol-1-yl-[1-(7H-purin-6-yl)pyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 172903825 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2,3-dihydroindol-1-yl-[1-(7H-purin-6-yl)pyrrolidin-3-yl]methanone |
| SMILES | O=C(C1CCN(c2ncnc3nc[nH]c23)C1)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H18N6O/c25-18(24-8-6-12-3-1-2-4-14(12)24)13-5-7-23(9-13)17-15-16(20-10-19-15)21-11-22-17/h1-4,10-11,13H,5-9H2,(H,19,20,21,22) |
| InChIKey | JOSANCCFDWOFGC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |