C19H20N6O — CID 172892648
2,3-dihydroindol-1-yl-[1-(7H-purin-6-yl)piperidin-4-yl]methanone (PubChem CID 172892648) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is 2,3-dihydroindol-1-yl-[1-(7H-purin-6-yl)piperidin-4-yl]methanone.
| Compound Name | 2,3-dihydroindol-1-yl-[1-(7H-purin-6-yl)piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 172892648 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2,3-dihydroindol-1-yl-[1-(7H-purin-6-yl)piperidin-4-yl]methanone |
| SMILES | O=C(C1CCN(c2ncnc3nc[nH]c23)CC1)N1CCc2ccccc21 |
| InChI | InChI=1S/C19H20N6O/c26-19(25-10-7-13-3-1-2-4-15(13)25)14-5-8-24(9-6-14)18-16-17(21-11-20-16)22-12-23-18/h1-4,11-12,14H,5-10H2,(H,20,21,22,23) |
| InChIKey | HTYIZCATPXASRR-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |