C15H15N5 — CID 172882054
6-(2-phenylpyrrolidin-1-yl)-7H-purine (PubChem CID 172882054) has the molecular formula C15H15N5 and a molecular weight of 265.32 g/mol. Its IUPAC name is 6-(2-phenylpyrrolidin-1-yl)-7H-purine.
| Compound Name | 6-(2-phenylpyrrolidin-1-yl)-7H-purine |
|---|---|
| PubChem CID | 172882054 |
| Molecular Formula | C15H15N5 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 6-(2-phenylpyrrolidin-1-yl)-7H-purine |
| SMILES | c1ccc(C2CCCN2c2ncnc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C15H15N5/c1-2-5-11(6-3-1)12-7-4-8-20(12)15-13-14(17-9-16-13)18-10-19-15/h1-3,5-6,9-10,12H,4,7-8H2,(H,16,17,18,19) |
| InChIKey | SIKQRYYVFJTKIO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |