C22H23ClN8O — CID 78321934
5-chloro-3-piperidin-1-yl-2-[(2S)-1-(7H-purin-6-yl)pyrrolidin-2-yl]quinazolin-4-one (PubChem CID 78321934) has the molecular formula C22H23ClN8O and a molecular weight of 450.93 g/mol. Its IUPAC name is 5-chloro-3-piperidin-1-yl-2-[(2S)-1-(7H-purin-6-yl)pyrrolidin-2-yl]quinazolin-4-one.
| Compound Name | 5-chloro-3-piperidin-1-yl-2-[(2S)-1-(7H-purin-6-yl)pyrrolidin-2-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 78321934 |
| Molecular Formula | C22H23ClN8O |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 5-chloro-3-piperidin-1-yl-2-[(2S)-1-(7H-purin-6-yl)pyrrolidin-2-yl]quinazolin-4-one |
| SMILES | O=c1c2c(Cl)cccc2nc([C@@H]2CCCN2c2ncnc3nc[nH]c23)n1N1CCCCC1 |
| InChI | InChI=1S/C22H23ClN8O/c23-14-6-4-7-15-17(14)22(32)31(29-9-2-1-3-10-29)20(28-15)16-8-5-11-30(16)21-18-19(25-12-24-18)26-13-27-21/h4,6-7,12-13,16H,1-3,5,8-11H2,(H,24,25,26,27)/t16-/m0/s1 |
| InChIKey | RLZOEYRIEDKRJN-INIZCTEOSA-N |
| XLogP | 3.18 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |