C21H21ClN8O — CID 90356544
5-chloro-2-[1-(7H-purin-6-yl)pyrrolidin-2-yl]-3-pyrrolidin-3-ylquinazolin-4-one (PubChem CID 90356544) has the molecular formula C21H21ClN8O and a molecular weight of 436.91 g/mol. Its IUPAC name is 5-chloro-2-[1-(7H-purin-6-yl)pyrrolidin-2-yl]-3-pyrrolidin-3-ylquinazolin-4-one.
| Compound Name | 5-chloro-2-[1-(7H-purin-6-yl)pyrrolidin-2-yl]-3-pyrrolidin-3-ylquinazolin-4-one |
|---|---|
| PubChem CID | 90356544 |
| Molecular Formula | C21H21ClN8O |
| Molecular Weight | 436.91 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 5-chloro-2-[1-(7H-purin-6-yl)pyrrolidin-2-yl]-3-pyrrolidin-3-ylquinazolin-4-one |
| SMILES | O=c1c2c(Cl)cccc2nc(C2CCCN2c2ncnc3nc[nH]c23)n1C1CCNC1 |
| InChI | InChI=1S/C21H21ClN8O/c22-13-3-1-4-14-16(13)21(31)30(12-6-7-23-9-12)19(28-14)15-5-2-8-29(15)20-17-18(25-10-24-17)26-11-27-20/h1,3-4,10-12,15,23H,2,5-9H2,(H,24,25,26,27) |
| InChIKey | KMJAEJSRTBSYJY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.91 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |