C16H17N5O — CID 94145823
6-[(2S)-2-(4-methoxyphenyl)pyrrolidin-1-yl]-7H-purine (PubChem CID 94145823) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 6-[(2S)-2-(4-methoxyphenyl)pyrrolidin-1-yl]-7H-purine.
| Compound Name | 6-[(2S)-2-(4-methoxyphenyl)pyrrolidin-1-yl]-7H-purine |
|---|---|
| PubChem CID | 94145823 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 6-[(2S)-2-(4-methoxyphenyl)pyrrolidin-1-yl]-7H-purine |
| SMILES | COc1ccc([C@@H]2CCCN2c2ncnc3nc[nH]c23)cc1 |
| InChI | InChI=1S/C16H17N5O/c1-22-12-6-4-11(5-7-12)13-3-2-8-21(13)16-14-15(18-9-17-14)19-10-20-16/h4-7,9-10,13H,2-3,8H2,1H3,(H,17,18,19,20)/t13-/m0/s1 |
| InChIKey | HQGLJBJNFQNIDY-ZDUSSCGKSA-N |
| XLogP | 2.70 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |