C23H25N5O2 — CID 58534769
6-[(2R)-2-[(7-propan-2-yloxynaphthalen-1-yl)oxymethyl]pyrrolidin-1-yl]-7H-purine (PubChem CID 58534769) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 6-[(2R)-2-[(7-propan-2-yloxynaphthalen-1-yl)oxymethyl]pyrrolidin-1-yl]-7H-purine.
| Compound Name | 6-[(2R)-2-[(7-propan-2-yloxynaphthalen-1-yl)oxymethyl]pyrrolidin-1-yl]-7H-purine |
|---|---|
| PubChem CID | 58534769 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 6-[(2R)-2-[(7-propan-2-yloxynaphthalen-1-yl)oxymethyl]pyrrolidin-1-yl]-7H-purine |
| SMILES | CC(C)Oc1ccc2cccc(OC[C@H]3CCCN3c3ncnc4nc[nH]c34)c2c1 |
| InChI | InChI=1S/C23H25N5O2/c1-15(2)30-18-9-8-16-5-3-7-20(19(16)11-18)29-12-17-6-4-10-28(17)23-21-22(25-13-24-21)26-14-27-23/h3,5,7-9,11,13-15,17H,4,6,10,12H2,1-2H3,(H,24,25,26,27)/t17-/m1/s1 |
| InChIKey | YECIGAZJSMWZFO-QGZVFWFLSA-N |
| XLogP | 4.34 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |