C19H18N6O — CID 67446413
4-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]isoquinoline (PubChem CID 67446413) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is 4-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]isoquinoline.
| Compound Name | 4-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]isoquinoline |
|---|---|
| PubChem CID | 67446413 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 4-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]isoquinoline |
| SMILES | c1ccc2c(OCC3CCCN3c3ncnc4nc[nH]c34)cncc2c1 |
| InChI | InChI=1S/C19H18N6O/c1-2-6-15-13(4-1)8-20-9-16(15)26-10-14-5-3-7-25(14)19-17-18(22-11-21-17)23-12-24-19/h1-2,4,6,8-9,11-12,14H,3,5,7,10H2,(H,21,22,23,24) |
| InChIKey | JDGSTFMPOORWTI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |