C20H19N5O2 — CID 67446443
8-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]naphthalen-2-ol (PubChem CID 67446443) has the molecular formula C20H19N5O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is 8-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]naphthalen-2-ol.
| Compound Name | 8-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]naphthalen-2-ol |
|---|---|
| PubChem CID | 67446443 |
| Molecular Formula | C20H19N5O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 8-[[1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]naphthalen-2-ol |
| SMILES | Oc1ccc2cccc(OCC3CCCN3c3ncnc4nc[nH]c34)c2c1 |
| InChI | InChI=1S/C20H19N5O2/c26-15-7-6-13-3-1-5-17(16(13)9-15)27-10-14-4-2-8-25(14)20-18-19(22-11-21-18)23-12-24-20/h1,3,5-7,9,11-12,14,26H,2,4,8,10H2,(H,21,22,23,24) |
| InChIKey | TWSMAIXNXOBLLM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |