About 8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine
8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine (PubChem CID 143922929) has the molecular formula C20H21N5O2
and a molecular weight of 363.42 g/mol. Its IUPAC name is 8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine.
Molecular Properties
| Compound Name | 8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine |
| PubChem CID | 143922929 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine |
| SMILES | COc1cccc2ccc(O)cc12.c1nc(N2CCCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H10O2.C9H11N5/c1-13-11-4-2-3-8-5-6-9(12)7-10(8)11;1-2-4-14(3-1)9-7-8(11-5-10-7)12-6-13-9/h2-7,12H,1H3;5-6H,1-4H2,(H,10,11,12,13) |
| InChIKey | OSBRFGDMFDHQIH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine?
The IUPAC name of 8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine (CID 143922929) is 8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine.
What is the SMILES notation for 8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine?
The canonical SMILES for 8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine is COc1cccc2ccc(O)cc12.c1nc(N2CCCC2)c2[nH]cnc2n1.
What is the InChIKey of 8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine?
The InChIKey is OSBRFGDMFDHQIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2.C9H11N5/c1-13-11-4-2-3-8-5-6-9(12)7-10(8)11;1-2-4-14(3-1)9-7-8(11-5-10-7)12-6-13-9/h2-7,12H,1H3;5-6H,1-4H2,(H,10,11,12,13).
What are the key properties of 8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine?
8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine has a molecular weight of 363.42 g/mol, XLogP of 3.51, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine is sourced from PubChem (CID 143922929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).