C20H21N5O2 — CID 143922929
8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine (PubChem CID 143922929) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine.
| Compound Name | 8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine |
|---|---|
| PubChem CID | 143922929 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 8-methoxynaphthalen-2-ol;6-pyrrolidin-1-yl-7H-purine |
| SMILES | COc1cccc2ccc(O)cc12.c1nc(N2CCCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H10O2.C9H11N5/c1-13-11-4-2-3-8-5-6-9(12)7-10(8)11;1-2-4-14(3-1)9-7-8(11-5-10-7)12-6-13-9/h2-7,12H,1H3;5-6H,1-4H2,(H,10,11,12,13) |
| InChIKey | OSBRFGDMFDHQIH-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 87.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |