C17H19N7O — CID 143922901
8-methoxyimidazo[1,2-a]pyridine;6-pyrrolidin-1-yl-7H-purine (PubChem CID 143922901) has the molecular formula C17H19N7O and a molecular weight of 337.39 g/mol. Its IUPAC name is 8-methoxyimidazo[1,2-a]pyridine;6-pyrrolidin-1-yl-7H-purine.
| Compound Name | 8-methoxyimidazo[1,2-a]pyridine;6-pyrrolidin-1-yl-7H-purine |
|---|---|
| PubChem CID | 143922901 |
| Molecular Formula | C17H19N7O |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 8-methoxyimidazo[1,2-a]pyridine;6-pyrrolidin-1-yl-7H-purine |
| SMILES | COc1cccn2ccnc12.c1nc(N2CCCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C9H11N5.C8H8N2O/c1-2-4-14(3-1)9-7-8(11-5-10-7)12-6-13-9;1-11-7-3-2-5-10-6-4-9-8(7)10/h5-6H,1-4H2,(H,10,11,12,13);2-6H,1H3 |
| InChIKey | VGFAGYSVKHFLRC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |