C14H14N10 — CID 166605581
6-[4-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperazin-1-yl]-7H-purine (PubChem CID 166605581) has the molecular formula C14H14N10 and a molecular weight of 322.34 g/mol. Its IUPAC name is 6-[4-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperazin-1-yl]-7H-purine.
| Compound Name | 6-[4-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperazin-1-yl]-7H-purine |
|---|---|
| PubChem CID | 166605581 |
| Molecular Formula | C14H14N10 |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 6-[4-([1,2,4]triazolo[4,3-a]pyrazin-8-yl)piperazin-1-yl]-7H-purine |
| SMILES | c1cn2cnnc2c(N2CCN(c3ncnc4nc[nH]c34)CC2)n1 |
| InChI | InChI=1S/C14H14N10/c1-2-24-9-20-21-14(24)13(15-1)23-5-3-22(4-6-23)12-10-11(17-7-16-10)18-8-19-12/h1-2,7-9H,3-6H2,(H,16,17,18,19) |
| InChIKey | YAYUKJWEECOATN-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |