C16H22N8 — CID 77092371
6-[4-[(1-propylimidazol-2-yl)methyl]piperazin-1-yl]-7H-purine (PubChem CID 77092371) has the molecular formula C16H22N8 and a molecular weight of 326.41 g/mol. Its IUPAC name is 6-[4-[(1-propylimidazol-2-yl)methyl]piperazin-1-yl]-7H-purine.
| Compound Name | 6-[4-[(1-propylimidazol-2-yl)methyl]piperazin-1-yl]-7H-purine |
|---|---|
| PubChem CID | 77092371 |
| Molecular Formula | C16H22N8 |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 6-[4-[(1-propylimidazol-2-yl)methyl]piperazin-1-yl]-7H-purine |
| SMILES | CCCn1ccnc1CN1CCN(c2ncnc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C16H22N8/c1-2-4-23-5-3-17-13(23)10-22-6-8-24(9-7-22)16-14-15(19-11-18-14)20-12-21-16/h3,5,11-12H,2,4,6-10H2,1H3,(H,18,19,20,21) |
| InChIKey | JOINWGGMJDFDNN-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |