C14H23N7 — CID 43252544
5-[4-(7H-purin-6-yl)piperazin-1-yl]pentan-1-amine (PubChem CID 43252544) has the molecular formula C14H23N7 and a molecular weight of 289.39 g/mol. Its IUPAC name is 5-[4-(7H-purin-6-yl)piperazin-1-yl]pentan-1-amine.
| Compound Name | 5-[4-(7H-purin-6-yl)piperazin-1-yl]pentan-1-amine |
|---|---|
| PubChem CID | 43252544 |
| Molecular Formula | C14H23N7 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 5-[4-(7H-purin-6-yl)piperazin-1-yl]pentan-1-amine |
| SMILES | NCCCCCN1CCN(c2ncnc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C14H23N7/c15-4-2-1-3-5-20-6-8-21(9-7-20)14-12-13(17-10-16-12)18-11-19-14/h10-11H,1-9,15H2,(H,16,17,18,19) |
| InChIKey | AEMTXDBJGDCLLZ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|