C17H18FN7O — CID 133417199
N-(2-fluorophenyl)-2-[4-(7H-purin-6-yl)piperazin-1-yl]acetamide (PubChem CID 133417199) has the molecular formula C17H18FN7O and a molecular weight of 355.38 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[4-(7H-purin-6-yl)piperazin-1-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[4-(7H-purin-6-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 133417199 |
| Molecular Formula | C17H18FN7O |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-(2-fluorophenyl)-2-[4-(7H-purin-6-yl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2ncnc3nc[nH]c23)CC1)Nc1ccccc1F |
| InChI | InChI=1S/C17H18FN7O/c18-12-3-1-2-4-13(12)23-14(26)9-24-5-7-25(8-6-24)17-15-16(20-10-19-15)21-11-22-17/h1-4,10-11H,5-9H2,(H,23,26)(H,19,20,21,22) |
| InChIKey | HNGPTNUBIJNCEW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |