C18H27N7O — CID 133293462
N-(3-methylcyclohexyl)-2-[4-(7H-purin-6-yl)piperazin-1-yl]acetamide (PubChem CID 133293462) has the molecular formula C18H27N7O and a molecular weight of 357.46 g/mol. Its IUPAC name is N-(3-methylcyclohexyl)-2-[4-(7H-purin-6-yl)piperazin-1-yl]acetamide.
| Compound Name | N-(3-methylcyclohexyl)-2-[4-(7H-purin-6-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 133293462 |
| Molecular Formula | C18H27N7O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | N-(3-methylcyclohexyl)-2-[4-(7H-purin-6-yl)piperazin-1-yl]acetamide |
| SMILES | CC1CCCC(NC(=O)CN2CCN(c3ncnc4nc[nH]c34)CC2)C1 |
| InChI | InChI=1S/C18H27N7O/c1-13-3-2-4-14(9-13)23-15(26)10-24-5-7-25(8-6-24)18-16-17(20-11-19-16)21-12-22-18/h11-14H,2-10H2,1H3,(H,23,26)(H,19,20,21,22) |
| InChIKey | BYZNSTBLUQCNMV-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |