C20H29F2N3O3S — CID 133293489
2-[4-[4-(difluoromethylsulfonyl)phenyl]piperazin-1-yl]-N-(3-methylcyclohexyl)acetamide (PubChem CID 133293489) has the molecular formula C20H29F2N3O3S and a molecular weight of 429.53 g/mol. Its IUPAC name is 2-[4-[4-(difluoromethylsulfonyl)phenyl]piperazin-1-yl]-N-(3-methylcyclohexyl)acetamide.
| Compound Name | 2-[4-[4-(difluoromethylsulfonyl)phenyl]piperazin-1-yl]-N-(3-methylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 133293489 |
| Molecular Formula | C20H29F2N3O3S |
| Molecular Weight | 429.53 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | 2-[4-[4-(difluoromethylsulfonyl)phenyl]piperazin-1-yl]-N-(3-methylcyclohexyl)acetamide |
| SMILES | CC1CCCC(NC(=O)CN2CCN(c3ccc(S(=O)(=O)C(F)F)cc3)CC2)C1 |
| InChI | InChI=1S/C20H29F2N3O3S/c1-15-3-2-4-16(13-15)23-19(26)14-24-9-11-25(12-10-24)17-5-7-18(8-6-17)29(27,28)20(21)22/h5-8,15-16,20H,2-4,9-14H2,1H3,(H,23,26) |
| InChIKey | YLTVNBAANDKVKE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.53 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |