C17H22N8S — CID 50982944
6-[4-[(2-propylsulfanylpyrimidin-5-yl)methyl]piperazin-1-yl]-7H-purine (PubChem CID 50982944) has the molecular formula C17H22N8S and a molecular weight of 370.49 g/mol. Its IUPAC name is 6-[4-[(2-propylsulfanylpyrimidin-5-yl)methyl]piperazin-1-yl]-7H-purine.
| Compound Name | 6-[4-[(2-propylsulfanylpyrimidin-5-yl)methyl]piperazin-1-yl]-7H-purine |
|---|---|
| PubChem CID | 50982944 |
| Molecular Formula | C17H22N8S |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 6-[4-[(2-propylsulfanylpyrimidin-5-yl)methyl]piperazin-1-yl]-7H-purine |
| SMILES | CCCSc1ncc(CN2CCN(c3ncnc4nc[nH]c34)CC2)cn1 |
| InChI | InChI=1S/C17H22N8S/c1-2-7-26-17-18-8-13(9-19-17)10-24-3-5-25(6-4-24)16-14-15(21-11-20-14)22-12-23-16/h8-9,11-12H,2-7,10H2,1H3,(H,20,21,22,23) |
| InChIKey | FGYTWPIUSBYKKE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |