C15H24N6 — CID 63854249
N-[1-[1-(7H-purin-6-yl)piperidin-4-yl]ethyl]propan-1-amine (PubChem CID 63854249) has the molecular formula C15H24N6 and a molecular weight of 288.40 g/mol. Its IUPAC name is N-[1-[1-(7H-purin-6-yl)piperidin-4-yl]ethyl]propan-1-amine.
| Compound Name | N-[1-[1-(7H-purin-6-yl)piperidin-4-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 63854249 |
| Molecular Formula | C15H24N6 |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | N-[1-[1-(7H-purin-6-yl)piperidin-4-yl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)C1CCN(c2ncnc3nc[nH]c23)CC1 |
| InChI | InChI=1S/C15H24N6/c1-3-6-16-11(2)12-4-7-21(8-5-12)15-13-14(18-9-17-13)19-10-20-15/h9-12,16H,3-8H2,1-2H3,(H,17,18,19,20) |
| InChIKey | FHQWNLQFAXKYJG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |