C20H24N6O2 — CID 143922864
(E)-3-(2-methoxyphenyl)-N-methylprop-2-enamide;6-pyrrolidin-1-yl-7H-purine (PubChem CID 143922864) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is (E)-3-(2-methoxyphenyl)-N-methylprop-2-enamide;6-pyrrolidin-1-yl-7H-purine.
| Compound Name | (E)-3-(2-methoxyphenyl)-N-methylprop-2-enamide;6-pyrrolidin-1-yl-7H-purine |
|---|---|
| PubChem CID | 143922864 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (E)-3-(2-methoxyphenyl)-N-methylprop-2-enamide;6-pyrrolidin-1-yl-7H-purine |
| SMILES | CNC(=O)/C=C/c1ccccc1OC.c1nc(N2CCCC2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C11H13NO2.C9H11N5/c1-12-11(13)8-7-9-5-3-4-6-10(9)14-2;1-2-4-14(3-1)9-7-8(11-5-10-7)12-6-13-9/h3-8H,1-2H3,(H,12,13);5-6H,1-4H2,(H,10,11,12,13)/b8-7+; |
| InChIKey | IICNUUNXTAHTMN-USRGLUTNSA-N |
| XLogP | 2.41 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|