C20H17F3N6O2 — CID 135284983
4-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]-8-(trifluoromethoxy)quinoline (PubChem CID 135284983) has the molecular formula C20H17F3N6O2 and a molecular weight of 430.39 g/mol. Its IUPAC name is 4-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]-8-(trifluoromethoxy)quinoline.
| Compound Name | 4-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]-8-(trifluoromethoxy)quinoline |
|---|---|
| PubChem CID | 135284983 |
| Molecular Formula | C20H17F3N6O2 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 4-[[(2R)-1-(7H-purin-6-yl)pyrrolidin-2-yl]methoxy]-8-(trifluoromethoxy)quinoline |
| SMILES | FC(F)(F)Oc1cccc2c(OC[C@H]3CCCN3c3ncnc4nc[nH]c34)ccnc12 |
| InChI | InChI=1S/C20H17F3N6O2/c21-20(22,23)31-15-5-1-4-13-14(6-7-24-16(13)15)30-9-12-3-2-8-29(12)19-17-18(26-10-25-17)27-11-28-19/h1,4-7,10-12H,2-3,8-9H2,(H,25,26,27,28)/t12-/m1/s1 |
| InChIKey | SYNUEPWTOIYPHI-GFCCVEGCSA-N |
| XLogP | 3.85 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |