C19H24Cl2N6O — CID 171330744
6-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-7H-purine;dihydrochloride (PubChem CID 171330744) has the molecular formula C19H24Cl2N6O and a molecular weight of 423.35 g/mol. Its IUPAC name is 6-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-7H-purine;dihydrochloride.
| Compound Name | 6-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-7H-purine;dihydrochloride |
|---|---|
| PubChem CID | 171330744 |
| Molecular Formula | C19H24Cl2N6O |
| Molecular Weight | 423.35 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 6-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-7H-purine;dihydrochloride |
| SMILES | COc1ccc([C@@H]2[C@@H]3CN(c4ncnc5nc[nH]c45)C[C@@H]3CN2C)cc1.Cl.Cl |
| InChI | InChI=1S/C19H22N6O.2ClH/c1-24-7-13-8-25(19-16-18(21-10-20-16)22-11-23-19)9-15(13)17(24)12-3-5-14(26-2)6-4-12;;/h3-6,10-11,13,15,17H,7-9H2,1-2H3,(H,20,21,22,23);2*1H/t13-,15+,17+;;/m0../s1 |
| InChIKey | KDEZSVAIAPTHHL-YMUZZGRNSA-N |
| XLogP | 2.94 |
| TPSA | 70.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |