C21H30Cl2N4O — CID 171329934
(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-5-(5-propylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride (PubChem CID 171329934) has the molecular formula C21H30Cl2N4O and a molecular weight of 425.40 g/mol. Its IUPAC name is (3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-5-(5-propylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride.
| Compound Name | (3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-5-(5-propylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 171329934 |
| Molecular Formula | C21H30Cl2N4O |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | (3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-5-(5-propylpyrimidin-2-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
| SMILES | CCCc1cnc(N2C[C@@H]3CN(C)[C@@H](c4ccc(OC)cc4)[C@@H]3C2)nc1.Cl.Cl |
| InChI | InChI=1S/C21H28N4O.2ClH/c1-4-5-15-10-22-21(23-11-15)25-13-17-12-24(2)20(19(17)14-25)16-6-8-18(26-3)9-7-16;;/h6-11,17,19-20H,4-5,12-14H2,1-3H3;2*1H/t17-,19+,20-;;/m0../s1 |
| InChIKey | DGPOFMYMACMPKN-HVOYFDFJSA-N |
| XLogP | 4.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |