C23H32Cl2N2O3 — CID 171329641
(3R,3aS,6aR)-5-[(3,5-dimethoxyphenyl)methyl]-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride (PubChem CID 171329641) has the molecular formula C23H32Cl2N2O3 and a molecular weight of 455.43 g/mol. Its IUPAC name is (3R,3aS,6aR)-5-[(3,5-dimethoxyphenyl)methyl]-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride.
| Compound Name | (3R,3aS,6aR)-5-[(3,5-dimethoxyphenyl)methyl]-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 171329641 |
| Molecular Formula | C23H32Cl2N2O3 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | (3R,3aS,6aR)-5-[(3,5-dimethoxyphenyl)methyl]-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
| SMILES | COc1ccc([C@H]2[C@@H]3CN(Cc4cc(OC)cc(OC)c4)C[C@@H]3CN2C)cc1.Cl.Cl |
| InChI | InChI=1S/C23H30N2O3.2ClH/c1-24-13-18-14-25(12-16-9-20(27-3)11-21(10-16)28-4)15-22(18)23(24)17-5-7-19(26-2)8-6-17;;/h5-11,18,22-23H,12-15H2,1-4H3;2*1H/t18-,22+,23-;;/m0../s1 |
| InChIKey | BLOWEHOZHMDSQX-GTROTSORSA-N |
| XLogP | 4.29 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |