C17H24Cl2N4OS — CID 171331019
2-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-methyl-1,3,4-thiadiazole;dihydrochloride (PubChem CID 171331019) has the molecular formula C17H24Cl2N4OS and a molecular weight of 403.38 g/mol. Its IUPAC name is 2-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-methyl-1,3,4-thiadiazole;dihydrochloride.
| Compound Name | 2-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-methyl-1,3,4-thiadiazole;dihydrochloride |
|---|---|
| PubChem CID | 171331019 |
| Molecular Formula | C17H24Cl2N4OS |
| Molecular Weight | 403.38 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 2-[(3S,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-5-methyl-1,3,4-thiadiazole;dihydrochloride |
| SMILES | COc1ccc([C@@H]2[C@@H]3CN(c4nnc(C)s4)C[C@@H]3CN2C)cc1.Cl.Cl |
| InChI | InChI=1S/C17H22N4OS.2ClH/c1-11-18-19-17(23-11)21-9-13-8-20(2)16(15(13)10-21)12-4-6-14(22-3)7-5-12;;/h4-7,13,15-16H,8-10H2,1-3H3;2*1H/t13-,15+,16+;;/m0../s1 |
| InChIKey | NSEQVHXGKZCRHU-IZQURSCRSA-N |
| XLogP | 3.44 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |