C20H24Cl2N4O — CID 171330097
6-[(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]pyridine-3-carbonitrile;dihydrochloride (PubChem CID 171330097) has the molecular formula C20H24Cl2N4O and a molecular weight of 407.35 g/mol. Its IUPAC name is 6-[(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]pyridine-3-carbonitrile;dihydrochloride.
| Compound Name | 6-[(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]pyridine-3-carbonitrile;dihydrochloride |
|---|---|
| PubChem CID | 171330097 |
| Molecular Formula | C20H24Cl2N4O |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 6-[(3R,3aS,6aS)-3-(4-methoxyphenyl)-2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]pyridine-3-carbonitrile;dihydrochloride |
| SMILES | COc1ccc([C@H]2[C@@H]3CN(c4ccc(C#N)cn4)C[C@@H]3CN2C)cc1.Cl.Cl |
| InChI | InChI=1S/C20H22N4O.2ClH/c1-23-11-16-12-24(19-8-3-14(9-21)10-22-19)13-18(16)20(23)15-4-6-17(25-2)7-5-15;;/h3-8,10,16,18,20H,11-13H2,1-2H3;2*1H/t16-,18+,20-;;/m0../s1 |
| InChIKey | NACSEFLSWZZQOQ-WECJYQQASA-N |
| XLogP | 3.54 |
| TPSA | 52.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |