C19H24Cl3N3 — CID 171330170
(3S,3aS,6aS)-5-(5-chloro-2-pyridinyl)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride (PubChem CID 171330170) has the molecular formula C19H24Cl3N3 and a molecular weight of 400.78 g/mol. Its IUPAC name is (3S,3aS,6aS)-5-(5-chloro-2-pyridinyl)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride.
| Compound Name | (3S,3aS,6aS)-5-(5-chloro-2-pyridinyl)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
|---|---|
| PubChem CID | 171330170 |
| Molecular Formula | C19H24Cl3N3 |
| Molecular Weight | 400.78 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | (3S,3aS,6aS)-5-(5-chloro-2-pyridinyl)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole;dihydrochloride |
| SMILES | Cc1ccccc1[C@@H]1[C@@H]2CN(c3ccc(Cl)cn3)C[C@@H]2CN1C.Cl.Cl |
| InChI | InChI=1S/C19H22ClN3.2ClH/c1-13-5-3-4-6-16(13)19-17-12-23(11-14(17)10-22(19)2)18-8-7-15(20)9-21-18;;/h3-9,14,17,19H,10-12H2,1-2H3;2*1H/t14-,17+,19+;;/m0../s1 |
| InChIKey | LRPILOUDRXIYLK-WISAYRBMSA-N |
| XLogP | 4.63 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.78 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |