C19H33Cl2N3O2S — CID 171330425
3-[(3R,3aS,6aR)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N,N-dimethylpropane-1-sulfonamide;dihydrochloride (PubChem CID 171330425) has the molecular formula C19H33Cl2N3O2S and a molecular weight of 438.47 g/mol. Its IUPAC name is 3-[(3R,3aS,6aR)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N,N-dimethylpropane-1-sulfonamide;dihydrochloride.
| Compound Name | 3-[(3R,3aS,6aR)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N,N-dimethylpropane-1-sulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 171330425 |
| Molecular Formula | C19H33Cl2N3O2S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 3-[(3R,3aS,6aR)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N,N-dimethylpropane-1-sulfonamide;dihydrochloride |
| SMILES | Cc1ccccc1[C@H]1[C@@H]2CN(CCCS(=O)(=O)N(C)C)C[C@@H]2CN1C.Cl.Cl |
| InChI | InChI=1S/C19H31N3O2S.2ClH/c1-15-8-5-6-9-17(15)19-18-14-22(13-16(18)12-21(19)4)10-7-11-25(23,24)20(2)3;;/h5-6,8-9,16,18-19H,7,10-14H2,1-4H3;2*1H/t16-,18+,19-;;/m0../s1 |
| InChIKey | STDSDKVAASBAHO-XFFDLPHBSA-N |
| XLogP | 2.65 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |