C21H26ClN3O3S — CID 171708474
4-[[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]benzamide;hydrochloride (PubChem CID 171708474) has the molecular formula C21H26ClN3O3S and a molecular weight of 435.98 g/mol. Its IUPAC name is 4-[[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]benzamide;hydrochloride.
| Compound Name | 4-[[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 171708474 |
| Molecular Formula | C21H26ClN3O3S |
| Molecular Weight | 435.98 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 4-[[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]sulfonyl]benzamide;hydrochloride |
| SMILES | Cc1ccccc1[C@@H]1[C@@H]2CN(S(=O)(=O)c3ccc(C(N)=O)cc3)C[C@@H]2CN1C.Cl |
| InChI | InChI=1S/C21H25N3O3S.ClH/c1-14-5-3-4-6-18(14)20-19-13-24(12-16(19)11-23(20)2)28(26,27)17-9-7-15(8-10-17)21(22)25;/h3-10,16,19-20H,11-13H2,1-2H3,(H2,22,25);1H/t16-,19+,20+;/m0./s1 |
| InChIKey | GMWYPRYYZQUZKX-NZEABCQBSA-N |
| XLogP | 2.44 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.98 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |