C20H29ClN2O — CID 171711431
[(3R,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclopentylmethanone;hydrochloride (PubChem CID 171711431) has the molecular formula C20H29ClN2O and a molecular weight of 348.92 g/mol. Its IUPAC name is [(3R,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclopentylmethanone;hydrochloride.
| Compound Name | [(3R,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclopentylmethanone;hydrochloride |
|---|---|
| PubChem CID | 171711431 |
| Molecular Formula | C20H29ClN2O |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | [(3R,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-cyclopentylmethanone;hydrochloride |
| SMILES | Cc1ccccc1[C@H]1[C@@H]2CN(C(=O)C3CCCC3)C[C@@H]2CN1C.Cl |
| InChI | InChI=1S/C20H28N2O.ClH/c1-14-7-3-6-10-17(14)19-18-13-22(12-16(18)11-21(19)2)20(23)15-8-4-5-9-15;/h3,6-7,10,15-16,18-19H,4-5,8-9,11-13H2,1-2H3;1H/t16-,18+,19-;/m0./s1 |
| InChIKey | YLPSAARQWASTJZ-DDBXZWFTSA-N |
| XLogP | 3.67 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |