C27H37Cl2N3O — CID 171322541
[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(piperidin-1-ylmethyl)phenyl]methanone;dihydrochloride (PubChem CID 171322541) has the molecular formula C27H37Cl2N3O and a molecular weight of 490.52 g/mol. Its IUPAC name is [(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(piperidin-1-ylmethyl)phenyl]methanone;dihydrochloride.
| Compound Name | [(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(piperidin-1-ylmethyl)phenyl]methanone;dihydrochloride |
|---|---|
| PubChem CID | 171322541 |
| Molecular Formula | C27H37Cl2N3O |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | [(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-[4-(piperidin-1-ylmethyl)phenyl]methanone;dihydrochloride |
| SMILES | Cc1ccccc1[C@@H]1[C@@H]2CN(C(=O)c3ccc(CN4CCCCC4)cc3)C[C@@H]2CN1C.Cl.Cl |
| InChI | InChI=1S/C27H35N3O.2ClH/c1-20-8-4-5-9-24(20)26-25-19-30(18-23(25)17-28(26)2)27(31)22-12-10-21(11-13-22)16-29-14-6-3-7-15-29;;/h4-5,8-13,23,25-26H,3,6-7,14-19H2,1-2H3;2*1H/t23-,25+,26+;;/m0../s1 |
| InChIKey | HDNLMFKGTLFXBK-MLCFGVKASA-N |
| XLogP | 5.20 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |