C23H29ClN2O3 — CID 171707593
[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dimethoxyphenyl)methanone;hydrochloride (PubChem CID 171707593) has the molecular formula C23H29ClN2O3 and a molecular weight of 416.95 g/mol. Its IUPAC name is [(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dimethoxyphenyl)methanone;hydrochloride.
| Compound Name | [(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dimethoxyphenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 171707593 |
| Molecular Formula | C23H29ClN2O3 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | [(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-(2,6-dimethoxyphenyl)methanone;hydrochloride |
| SMILES | COc1cccc(OC)c1C(=O)N1C[C@@H]2CN(C)[C@H](c3ccccc3C)[C@@H]2C1.Cl |
| InChI | InChI=1S/C23H28N2O3.ClH/c1-15-8-5-6-9-17(15)22-18-14-25(13-16(18)12-24(22)2)23(26)21-19(27-3)10-7-11-20(21)28-4;/h5-11,16,18,22H,12-14H2,1-4H3;1H/t16-,18+,22+;/m0./s1 |
| InChIKey | LSQRYKKGMDGXIY-DZVWYLRVSA-N |
| XLogP | 3.81 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |