C22H27Cl2N3O2 — CID 171710655
(3R,3aS,6aS)-N-(3-chloro-4-methoxyphenyl)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide;hydrochloride (PubChem CID 171710655) has the molecular formula C22H27Cl2N3O2 and a molecular weight of 436.38 g/mol. Its IUPAC name is (3R,3aS,6aS)-N-(3-chloro-4-methoxyphenyl)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide;hydrochloride.
| Compound Name | (3R,3aS,6aS)-N-(3-chloro-4-methoxyphenyl)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 171710655 |
| Molecular Formula | C22H27Cl2N3O2 |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | (3R,3aS,6aS)-N-(3-chloro-4-methoxyphenyl)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxamide;hydrochloride |
| SMILES | COc1ccc(NC(=O)N2C[C@@H]3CN(C)[C@@H](c4ccccc4C)[C@@H]3C2)cc1Cl.Cl |
| InChI | InChI=1S/C22H26ClN3O2.ClH/c1-14-6-4-5-7-17(14)21-18-13-26(12-15(18)11-25(21)2)22(27)24-16-8-9-20(28-3)19(23)10-16;/h4-10,15,18,21H,11-13H2,1-3H3,(H,24,27);1H/t15-,18+,21-;/m0./s1 |
| InChIKey | PMQNGXCDZVLVNW-ZZBVMRJNSA-N |
| XLogP | 4.85 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |