C22H28ClN3O2 — CID 171710221
3-[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-1,6-dimethylpyridin-2-one;hydrochloride (PubChem CID 171710221) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is 3-[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-1,6-dimethylpyridin-2-one;hydrochloride.
| Compound Name | 3-[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-1,6-dimethylpyridin-2-one;hydrochloride |
|---|---|
| PubChem CID | 171710221 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 3-[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-1,6-dimethylpyridin-2-one;hydrochloride |
| SMILES | Cc1ccccc1[C@@H]1[C@@H]2CN(C(=O)c3ccc(C)n(C)c3=O)C[C@@H]2CN1C.Cl |
| InChI | InChI=1S/C22H27N3O2.ClH/c1-14-7-5-6-8-17(14)20-19-13-25(12-16(19)11-23(20)3)22(27)18-10-9-15(2)24(4)21(18)26;/h5-10,16,19-20H,11-13H2,1-4H3;1H/t16-,19+,20+;/m0./s1 |
| InChIKey | WPXDUNUYJMSVEH-NZEABCQBSA-N |
| XLogP | 2.80 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |