C18H29Cl2N3O — CID 171325467
1-[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-amino-2-methylpropan-1-one;dihydrochloride (PubChem CID 171325467) has the molecular formula C18H29Cl2N3O and a molecular weight of 374.36 g/mol. Its IUPAC name is 1-[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-amino-2-methylpropan-1-one;dihydrochloride.
| Compound Name | 1-[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-amino-2-methylpropan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 171325467 |
| Molecular Formula | C18H29Cl2N3O |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 1-[(3S,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-amino-2-methylpropan-1-one;dihydrochloride |
| SMILES | Cc1ccccc1[C@@H]1[C@@H]2CN(C(=O)C(C)(C)N)C[C@@H]2CN1C.Cl.Cl |
| InChI | InChI=1S/C18H27N3O.2ClH/c1-12-7-5-6-8-14(12)16-15-11-21(17(22)18(2,3)19)10-13(15)9-20(16)4;;/h5-8,13,15-16H,9-11,19H2,1-4H3;2*1H/t13-,15+,16+;;/m0../s1 |
| InChIKey | OCQXQPFEVMEJKQ-IZQURSCRSA-N |
| XLogP | 2.64 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |