C23H29ClN2O3 — CID 171707919
1-[(3R,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(2-methoxyphenoxy)ethanone;hydrochloride (PubChem CID 171707919) has the molecular formula C23H29ClN2O3 and a molecular weight of 416.95 g/mol. Its IUPAC name is 1-[(3R,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(2-methoxyphenoxy)ethanone;hydrochloride.
| Compound Name | 1-[(3R,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(2-methoxyphenoxy)ethanone;hydrochloride |
|---|---|
| PubChem CID | 171707919 |
| Molecular Formula | C23H29ClN2O3 |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 1-[(3R,3aS,6aS)-2-methyl-3-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-2-(2-methoxyphenoxy)ethanone;hydrochloride |
| SMILES | COc1ccccc1OCC(=O)N1C[C@@H]2CN(C)[C@@H](c3ccccc3C)[C@@H]2C1.Cl |
| InChI | InChI=1S/C23H28N2O3.ClH/c1-16-8-4-5-9-18(16)23-19-14-25(13-17(19)12-24(23)2)22(26)15-28-21-11-7-6-10-20(21)27-3;/h4-11,17,19,23H,12-15H2,1-3H3;1H/t17-,19+,23-;/m0./s1 |
| InChIKey | UVBLQTQJDRIARC-MZUASJAOSA-N |
| XLogP | 3.57 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |