C23H34N2O3 — CID 170504238
1-[(3aR,4S,6aS)-2-(3-methoxypropanoyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4-methylpentan-1-one (PubChem CID 170504238) has the molecular formula C23H34N2O3 and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-[(3aR,4S,6aS)-2-(3-methoxypropanoyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4-methylpentan-1-one.
| Compound Name | 1-[(3aR,4S,6aS)-2-(3-methoxypropanoyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4-methylpentan-1-one |
|---|---|
| PubChem CID | 170504238 |
| Molecular Formula | C23H34N2O3 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | 1-[(3aR,4S,6aS)-2-(3-methoxypropanoyl)-4-(2-methylphenyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-4-methylpentan-1-one |
| SMILES | COCCC(=O)N1C[C@H]2CN(C(=O)CCC(C)C)[C@H](c3ccccc3C)[C@H]2C1 |
| InChI | InChI=1S/C23H34N2O3/c1-16(2)9-10-22(27)25-14-18-13-24(21(26)11-12-28-4)15-20(18)23(25)19-8-6-5-7-17(19)3/h5-8,16,18,20,23H,9-15H2,1-4H3/t18-,20-,23+/m0/s1 |
| InChIKey | SFJVVZQTUSBKAT-GREBRCKQSA-N |
| XLogP | 3.43 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |